| Identification | |
| Name: | 1H-Benzimidazole,5,6-dichloro- |
| Synonyms: | Benzimidazole,5,6-dichloro- (6CI,7CI,8CI); 5,6-Dichloro-1H-benzimidazole;5,6-Dichlorobenzimidazole; NSC 326397; NSC 63938 |
| CAS: | 6478-73-5 |
| Molecular Formula: | C7H4 Cl2 N2 |
| Molecular Weight: | 187.02816 |
| InChI: | InChI=1/C7H4Cl2N2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 244.6°C |
| Boiling Point: | 426.9°C at 760 mmHg |
| Density: | 1.571g/cm3 |
| Refractive index: | 1.708 |
| Specification: | Purple Solid usageEng:A benzimidazole derivative as potent inhibitor of milk xanthine oxidase Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 244.6°C |
| Usage: |
5,6-Dichlorobenzimidazole (CAS NO.6478-73-5) isa benzimidazole derivative and used as potent inhibitor of milk xanthine oxidase. |
| Safety Data | |
 |
|
