Identification |
Name: | Aspartic acid, diesterwith 2-hydroxyacetophenone, hydrobromide, L- (8CI) |
Synonyms: | Asparticacid, diester with 2-hydroxyacetophenone, hydrobromide (7CI) |
CAS: | 6479-57-8 |
Molecular Formula: | C20H19 N O6 . Br H |
Molecular Weight: | 379.2881 |
InChI: | InChI=1/C19H23BrO3/c1-3-21-16-7-9-17(10-8-16)22-12-4-5-13-23-19-11-6-15(2)14-18(19)20/h6-11,14H,3-5,12-13H2,1-2H3 |
Molecular Structure: |
![(C20H19NO6.BrH) Asparticacid, diester with 2-hydroxyacetophenone, hydrobromide (7CI)](https://img1.guidechem.com/chem/e/dict/4/6479-57-8.gif) |
Properties |
Flash Point: | 202.7°C |
Boiling Point: | 485.1°C at 760 mmHg |
Density: | 1.246g/cm3 |
Refractive index: | 1.549 |
Flash Point: | 202.7°C |
Safety Data |
|
![](/images/detail_15.png) |