| Identification |
| Name: | 2,4-Thiazolidinedione,5-(6-quinoxalinylmethylene)- |
| Synonyms: | 5-(Quinoxalin-6-ylmethylene)thiazolidine-2,4-dione;AS 605240 |
| CAS: | 648450-29-7 |
| Molecular Formula: | C12H7 N3 O2 S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H7N3O2S/c16-11-10(18-12(17)15-11)6-7-1-2-8-9(5-7)14-4-3-13-8/h1-6H,(H,15,16,17)/b10-6+ |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.553g/cm3 |
| Refractive index: | 1.792 |
| Biological Activity: | Potent and selective inhibitor of PI 3-kinase γ (PI3K γ ) (IC 50 = 8 nM). Displays 30-fold selectivity over PI3K δ and PI3K β and 7.5-fold selectivity over PI3K α . Suppresses the progression of joint inflammation and damage in both lymphocyte-independent and lymphocyte-dependent mouse models of rheumatoid arthritis. Orally active and ATP-competitive. |
| Safety Data |
| |
 |
