| Identification | |
| Name: | L(-)-Carvone |
| Synonyms: | 2-Cyclohexen-1-one,2-methyl-5-(1-methylethenyl)-, (R)-;p-Mentha-6,8-dien-2-one, (R)-(-)- (8CI);(-)-(5R)-Carvone;(-)-(R)-Carvone; |
| CAS: | 6485-40-1 |
| EINECS: | 229-352-5 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.22 |
| InChI: | InChI=1/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 25.2 |
| Density: | 0.958 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.495-1.502 |
| Alpha: | -57 o (NEAT) |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | Insoluble |
| Appearance: | Clear colorless to pale yellow liquid. odor of spearmint. |
| Specification: |
?(-)-Carvone (CAS NO.6485-40-1) is also named as (R)-2-Methyl-5-(1-methylethenyl)-2-cyclohexen-1-one ; (R)-Carvone ; AI3-36200 ; L(-)-Carvone ; UNII-5TO7X34D3D ; l-1-Methyl-4-isopropenyl-6-cyclohexen-2-one ; l-6,8(9)-p-Menthadien-2-one ; l-Carvone ; l-Carvone (natural) ; p-Mentha-6,8-dien-2-one, (-)-?; 2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (5R)- ; 2-Cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)-, (R)- (9CI) .?(-)-Carvone (CAS NO.6485-40-1) is clear colorless to pale yellow liquid. S-(+)-carvone smells like caraway. Its mirror image, R-(-)-carvone, smells like spearmint. |
| HS Code: | 29142900 |
| Color: | Colorless to slightly yellow liquid |
| Usage: | Used in the food, flavoing and air freshening products.3. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
