| Identification | |
| Name: | Trisulfide,bis(phenylmethyl) |
| Synonyms: | Benzyltrisulfide (6CI,7CI,8CI); Dibenzyl trisulfide |
| CAS: | 6493-73-8 |
| Molecular Formula: | C14H14 S3 |
| Molecular Weight: | 278.46 |
| InChI: | InChI=1/C14H14S3/c1-3-7-13(8-4-1)11-15-17-16-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 46-48 °C(lit.) |
| Flash Point: | 214.9°C |
| Boiling Point: | 160-163 °C0.01 mm Hg(lit.) |
| Density: | 1.238g/cm3 |
| Refractive index: | 1.672 |
| Specification: | White Solid usageEng:A secondary metabolite of Petiveria alliacea, on erythrocyte elasticity, relaxation time and membrane morphol. An antibacterial and antifungal agent. |
| Flash Point: | 214.9°C |
| Storage Temperature: | -20?C Freezer |
| Usage: | A secondary metabolite of Petiveria alliacea, on erythrocyte elasticity, relaxation time and membrane morphol. An antibacterial and antifungal agent. |
| Safety Data | |
 |
|
