| Identification | |
| Name: | ethyl 2-(formylamino)-4-thiazoleacetate |
| Synonyms: | Ethyl 2-(2-formylaminothiazol-4-yl) acetate; EFTA |
| CAS: | 64987-05-9 |
| EINECS: | 265-300-8 |
| Molecular Formula: | C8H10N2O3S |
| Molecular Weight: | 214.24 |
| InChI: | InChI=1/C8H10N2O3S/c1-2-13-7(12)3-6-4-14-8(10-6)9-5-11/h4-5H,2-3H2,1H3,(H,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 160.3°C |
| Boiling Point: | 341.4°C at 760 mmHg |
| Density: | 1.354g/cm3 |
| Refractive index: | 1.586 |
| Specification: |
Ethyl 2-formamidothiazol-4-acetate , with CAS number of 64987-05-9, can be called 4-thiazoleacetic acid, 2-(formylamino)-, ethyl ester ; Ethyl (2-formamido-1,3-thiazol-4-yl)acetate ; ethyl [2-(formylamino)-1,3-thiazol-4-yl]acetate . |
| Flash Point: | 160.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
