| Identification | |
| Name: | Benzene,1-(ethoxymethyl)-2-methoxy- |
| Synonyms: | Ethylo-methoxybenzyl ether |
| CAS: | 64988-06-3 |
| EINECS: | 265-301-3 |
| Molecular Formula: | C10H14 O2 |
| Molecular Weight: | 166.24 |
| InChI: | InChI=1/C10H14O2/c1-3-12-8-9-6-4-5-7-10(9)11-2/h4-7H,3,8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 69.9°C |
| Boiling Point: | 212.9°C at 760 mmHg |
| Density: | 0.982g/cm3 |
| Refractive index: | 1.489 |
| Specification: |
1-(Ethoxymethyl)-2-methoxybenzene with CAS number of 64988-06-3 is also known as O-(ethoxymethyl)anisole ; Ethyl2-methoxybenzylether ; Corps eglantine ; o-(Ethoxymethyl)anisol ; (2-Methoxybenzyl)ethyl ether ; 1-(Ethoxymethyl)-2-methoxybenzene . It can be used as flavor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 69.9°C |
| Safety Data | |
 |
|
