| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedione,5-methyl- |
| Synonyms: | Thymine(8CI); 2,4-Dihydroxy-5-methylpyrimidine; 4-Hydroxy-5-methylpyrimidin-2(1H)-one;5-Methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione;5-Methyl-2,4(1H,3H)-pyrimidinedione; 5-Methyl-2,4-dihydroxypyrimidine;5-Methylpyrimidine-2,4-dione; 5-Methyluracil; NSC 14705; NSC 168663 |
| CAS: | 65-71-4 |
| EINECS: | 200-616-1 |
| Molecular Formula: | C5H6 N2 O2 |
| Molecular Weight: | 126.11334 |
| InChI: | InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Flash Point: | 198 oC |
| Density: | 1.226 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.489 |
| Solubility: | Appearance:fine off-white crystalline powder Transport Information:20kgs Hazard Symbols:UN NO. MSDS:View |
| Appearance: | fine off-white crystalline powder |
| Specification: | White crystalline powder Safety Statements:22-24/25-37/39-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 198 oC |
| Storage Temperature: | Store at RT. |
| Usage: | Substance is used in biochemical research. |
| Safety Data | |
| Hazard Symbols | |
 |
|
