| Identification | |
| Name: | Tetracyclo[2.2.0.02,6.03,5]hexane |
| Synonyms: | Ladenburgbenzene; Prisman; Prismane; Tetracyclo[3.1.0.02,4.03,6]hexane; Triprismane;[3]Prismane |
| CAS: | 650-42-0 |
| Molecular Formula: | C6H6 |
| Molecular Weight: | 78.11 |
| InChI: | InChI=1/C6H6/c1-2-3(1)6-4(1)5(2)6/h1-6H |
| Molecular Structure: | ![(C6H6) Ladenburgbenzene; Prisman; Prismane; Tetracyclo[3.1.0.02,4.03,6]hexane; Triprismane;[3]Prismane](https://img1.guidechem.com/chem/e/dict/223/650-42-0.jpg) |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | 79.8°Cat760mmHg |
| Density: | 1.577g/cm3 |
| Refractive index: | 1.834 |
| Specification: |
Prismane (CAS NO.650-42-0) is explosive, which is unusual for a hydrocarbon. Due to this ring strain, the bonds have a low bond energy and break at a low activation energy, which makes synthesis of the molecule difficult. The molecule in which all six hydrogens are substituted by methyl groups (hexamethylprismane) has a higher stability and was synthesized by rearrangement reactions in 1966. |
| Flash Point: | °C |
| Safety Data | |
 |
|
