| Identification | |
| Name: | dimethyl benzene-1,3-dicarboxylate - 2,2,4-trimethylpentane-1,3-diol (1:1) |
| Synonyms: | AC1O5ALJ;Dimethyl isophthalate, 2,2,4-trimethyl-1,3-pentanediol polymer;dimethyl benzene-1,3-dicarboxylate; 2,2,4-trimethylpentane-1,3-diol;1,3-Benzenedicarboxylic acid, dimethyl ester, polymer with 2,2,4-trimethyl-1,3-pentanediol;1,3-Benzenedicarboxylic acid, 1,3-dimethyl ester, polymer with 2,2,4-trimethyl-1,3-pentanediol;65072-12-0 |
| CAS: | 65072-12-0 |
| Molecular Formula: | C18H28O6 |
| Molecular Weight: | 340.4113 |
| InChI: | InChI=1/C10H10O4.C8H18O2/c1-13-9(11)7-4-3-5-8(6-7)10(12)14-2;1-6(2)7(10)8(3,4)5-9/h3-6H,1-2H3;6-7,9-10H,5H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148°C |
| Boiling Point: | 285°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 148°C |
| Safety Data | |
 |
|
