Identification |
Name: | 2-Propenoic acid, 2-methyl-, 2-(diethylamino)ethyl ester, polymer with ethenylbenzene and tridecyl 2-methyl-2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, 2-(diethylamino)ethyl ester, polymer with ethenylbenzene and tridecyl 2-methyl-2-propenoate |
CAS: | 65086-64-8 |
Molecular Formula: | C35H59NO4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C17H32O2.C10H19NO2.C8H8/c1-4-5-6-7-8-9-10-11-12-13-14-15-19-17(18)16(2)3;1-5-11(6-2)7-8-13-10(12)9(3)4;1-2-8-6-4-3-5-7-8/h2,4-15H2,1,3H3;3,5-8H2,1-2,4H3;2-7H,1H2 |
Molecular Structure: |
![(C35H59NO4) 2-Propenoic acid, 2-methyl-, 2-(diethylamino)ethyl ester, polymer with ethenylbenzene and tridecyl 2...](https://img1.guidechem.com/chem/e/dict/49/174078.png) |
Properties |
Flash Point: | 142.9°C |
Boiling Point: | 339°C at 760 mmHg |
Flash Point: | 142.9°C |
Safety Data |
|
![](/images/detail_15.png) |