| Identification | |
| Name: | 5H-Dibenz[b,f]azepine-5-propanamine,10,11-dihydro-N-(methyl-d3)- (9CI) |
| Synonyms: | IMIPRAMINE-D3;10,11-Dihydro-N-(methyl-d3)-5H-dibenz[b,f]azepine-5-propanamine;Desipramine Methyl-d3;G-35020-d3;JB-8181-d3;Norpramin-d3;Nortimil-d3;NSC-114901-d3 |
| CAS: | 65100-49-4 |
| Molecular Formula: | C18H19 D3 N2 |
| Molecular Weight: | 284.41 |
| InChI: | InChI=1/C18H22N2/c1-19-13-6-14-20-17-9-4-2-7-15(17)11-12-16-8-3-5-10-18(16)20/h2-5,7-10,19H,6,11-14H2,1H3/i1D3 |
| Molecular Structure: | ![(C18H19D3N2) IMIPRAMINE-D3;10,11-Dihydro-N-(methyl-d3)-5H-dibenz[b,f]azepine-5-propanamine;Desipramine Methyl-d3;...](https://img1.guidechem.com/chem/e/dict/13/65100-49-4.jpg) |
| Properties | |
| Flash Point: | 160.458°C |
| Boiling Point: | 407.415°C at 760 mmHg |
| Density: | 1.059g/cm3 |
| Refractive index: | 1.576 |
| Specification: | Clear Colorless Oil usageEng:Labelled tricyclic antidepresant that is a more potent inhibitor of the norepinephrine transporter than the serotonin transporter |
| Flash Point: | 160.458°C |
| Usage: | Labelled tricyclic antidepresant that is a more potent inhibitor of the norepinephrine transporter than the serotonin transporter |
| Safety Data | |
 |
|
