| Identification | |
| Name: | 3,5,6-Trichloro-2-pyridinol |
| Synonyms: | 2(1H)-Pyridinone, 3,5,6-trichloro-; 2(1H)-Pyridone, 3,5,6-trichloro-; 2(1H)-pyridone,3,5,6-trichloro-; 2-Pyridinol, 3,5,6-trichloro-; 2-pyridinol,3,5,6-trichloro-; 3,5,6 Trichloro 2-pyridinal; 3,5,6-trichloropyridine-2-ol; Hydroxy-3,5,6-trichloropyridine |
| CAS: | 6515-38-4 |
| EINECS: | 229-405-2 |
| Molecular Formula: | C5H2Cl3NO |
| Molecular Weight: | 198.43 |
| InChI: | InChI=1/C5H2Cl3NO/c6-2-1-3(7)5(10)9-4(2)8/h1H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.955 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.556 |
| Appearance: | powder |
| Specification: | powder usageEng:A metabolite of Chlorpyrifos (C425300). Safety Statements:26-39-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Chlorpyrifos (C425300). |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
