| Identification |
| Name: | 1-Piperidinecarboxylicacid, 4-hydroxy-, ethyl ester |
| Synonyms: | 4-Oxypiperidine-1-carboxylicacid ethyl ester;Ethyl 4-hydroxy-1-piperidinecarboxylate;NSC 71891; |
| CAS: | 65214-82-6 |
| EINECS: | 265-636-5 |
| Molecular Formula: | C8H15NO3 |
| Molecular Weight: | 173.2096 |
| InChI: | InChI=1S/C8H15NO3/c1-2-12-8(11)9-5-3-7(10)4-6-9/h7,10H,2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.165 g/cm3 |
| Refractive index: | 1.488 |
| Water Solubility: | Soluble in water and alcohol |
| Solubility: | Soluble in water and alcohol |
| Appearance: | pale yellow coloured liquid |
| Safety Data |
| |
 |
