Identification |
Name: | 2,3,4,5,6-Pentafluorostyrene |
Synonyms: | Benzene,ethenylpentafluoro- (9CI);Styrene, 2,3,4,5,6-pentafluoro- (6CI,7CI,8CI);(Pentafluorophenyl)ethene;(Perfluorophenyl)ethylene;Ethenylpentafluorobenzene;NSC 97009;Pentafluoro(vinyl)benzene;Pentafluorostyrene;Vinylpentafluorobenzene;ar-Pentafluorostyrene;2',3',4',5',6'-Pentafluorostyrene; |
CAS: | 653-34-9 |
EINECS: | 211-500-5 |
Molecular Formula: | C8H3F5 |
Molecular Weight: | 194.1014 |
InChI: | InChI=1S/C8H3F5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 |
Density: | 1.406 |
Stability: | Flammable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.446 |
Appearance: | colourless liquid |
Specification: |
2,3,4,5,6-Pentafluorostyrene , its cas register number is 653-34-9. It also can be called 2',3',4',5',6'-Pentafluorostyrene ; Benzene,ethenylpentafluoro- (9CI) ; (Pentafluorophenyl)ethene .It is a colourless liquid.
|
Packinggroup: | III |
Storage Temperature: | −20°C |
Safety Data |
|
 |