Identification |
Name: | Benzeneacetic acid, a-(hydroxymethyl)-, (1a,2b,4b,5a,7b)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-ylester, hydrobromide, hydrate (1:1:3), (aS)- |
Synonyms: | Benzeneaceticacid, a-(hydroxymethyl)-, (1a,2b,4b,5a,7b)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-ylester, hydrobromide, trihydrate, (aS)- (9CI); Benzeneacetic acid, a-(hydroxymethyl)-,9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, hydrobromide,trihydrate, [7(S)-(1a,2b,4b,5a,7b)]-;3-Oxa-9-azatricyclo[3.3.1.02,4]nonane, benzeneacetic acid deriv.;(-)-Scopolamine hydrobromide trihydrate; Hyoscine hydrobromide trihydrate;Scopolamine hydrobromide trihydrate |
CAS: | 6533-68-2 |
EINECS: | 200-090-3 |
Molecular Formula: | C17H28BrNO7 |
Molecular Weight: | 438.31072 |
InChI: | InChI=1S/C17H21NO4.BrH.3H2O/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;;;;/h2-6,11-16,19H,7-9H2,1H3;1H;3*1H2/t11?,12?,13-,14-,15-,16+;;;;/m0..../s1 |
Molecular Structure: |
![(C17H28BrNO7) Benzeneaceticacid, a-(hydroxymethyl)-, (1a,2b,4b,5a,7b)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-...](https://img1.guidechem.com/chem/e/dict/36/6533-68-2.jpg) |
Properties |
Transport: | UN1544 6.1/PG 3 |
Density: | 1.31 g/cm3 |
Stability: | Stable, but air and light sensitive. Incompatible with acids, bases, strong oxidizing agents. Slightly hygroscopic. |
Refractive index: | -25.5 ° (C=5, H2O) |
Water Solubility: | 1.0 gm/1.5 mL (NTP, 1992) |
Solubility: | 1.0 gm/1.5 mL (NTP, 1992) |
Appearance: | WHITE TO OFF-WHITE POWDER |
Specification: |
Fire Hazard: Flash point data for Scopolamine hydrobromide trihydrate (6533-68-2)
are not available.Scopolamine hydrobromide trihydrate is probably combustible.
|
Storage Temperature: | Poison room |
Safety Data |
Hazard Symbols |
T+: Very toxic
|
|
 |