| Identification | |
| Name: | Quinoline,8-bromo-4-chloro- |
| Synonyms: | 8-Bromo-4-chloroquinoline; |
| CAS: | 65340-71-8 |
| Molecular Formula: | C9H5BrClN |
| Molecular Weight: | 242.5 |
| InChI: | InChI=1/C9H5BrClN/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.673 g/cm3 |
| Refractive index: | 1.68 |
| Specification: |
The 8-Bromo-4-chloroquinoline, with the cas registry number of 65340-71-8, is also called quinoline, 8-bromo-4-chloro-. The molecular formula of the chemical is C9H5BrClN. The characteristics of this chemical are as followings: (1)ACD/LogP: 3.55; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.55; (4)ACD/LogD (pH 7.4): 3.55; (5)ACD/BCF (pH 5.5): 294.13; (6)ACD/BCF (pH 7.4): 294.14; (7)ACD/KOC (pH 5.5): 2035.08; (8)ACD/KOC (pH 7.4): 2035.13; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 12.89 Å2; (13)Index of Refraction: 1.68; (14)Molar Refractivity: 54.77 cm3; (15)Molar Volume: 144.9 cm3; (16)Polarizability: 21.71×10-24cm3; (17)Surface Tension: 53.3 dyne/cm; (18)Density: 1.673 g/cm3; (19)Flash Point: 144.1 °C; (20)Enthalpy of Vaporization: 53.36 kJ/mol; (21)Boiling Point: 314.6 °C at 760 mmHg; (22)Vapour Pressure: 0.000853 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
