| Identification | |
| Name: | 4-Quinolinamine,8-bromo- |
| Synonyms: | 4-Amino-8-bromoquinoline; |
| CAS: | 65340-75-2 |
| Molecular Formula: | C9H7BrN2 |
| Molecular Weight: | 223.07 |
| InChI: | InChI=1/C9H7BrN2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-5H,(H2,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.649 g/cm3 |
| Refractive index: | 1.732 |
| Specification: |
The CAS register number of 4-Amino-8-bromoquinoline is 65340-75-2. It also can be called as 4-quinolinamine, 8-bromo- and the systematic name about this chemical is 8-bromoquinolin-4-amine. Its molecular formula is C9H7BrN2 and molecular weight is 223.07. Physical properties about 4-Amino-8-bromoquinoline are: (1)ACD/LogP: 2.40; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.5; (4)ACD/LogD (pH 7.4): 2.36; (5)#H bond acceptors: 2; (6)#H bond donors: 2; (7)#Freely Rotating Bonds: 1; (8)Polar Surface Area: 38.91Å2; (9)Index of Refraction: 1.732; (10)Molar Refractivity: 54.11 cm3; (11)Molar Volume: 135.2 cm3; (12)Surface Tension: 63.3 dyne/cm; (13)Density: 1.649 g/cm3; (14)Flash Point: 188.9 °C; (15)Enthalpy of Vaporization: 63.79 kJ/mol; (16)Boiling Point: 388.7 °C at 760 mmHg; (17)Vapour Pressure: 3.01E-06 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
