| Identification | |
| Name: | [1,1'-Bicyclohexyl]-4-carboxylicacid, 4'-propyl-, (trans,trans)- |
| Synonyms: | (trans,trans)-4'-Propyl-1,1'-bicyclohexyl-4-carboxylicacid; trans-4-(4-Propylcyclohexyl)cyclohexanecarboxylic acid;trans-4-(trans-4-Propylcyclohexyl)cyclohexanecarboxylic acid |
| CAS: | 65355-32-0 |
| Molecular Formula: | C16H28 O2 |
| Molecular Weight: | 252.39 |
| InChI: | InChI=1/C16H28O2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h12-15H,2-11H2,1H3,(H,17,18)/t12?,13?,14-,15- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 178.8°C |
| Boiling Point: | 370.9°C at 760 mmHg |
| Density: | 0.998g/cm3 |
| Refractive index: | 1.492 |
| Specification: |
4-trans-Propyl cyclohexyl cyclohexyl carboxylic acid ,its cas register number is 65355-32-0. It also can be called trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid ; and [1,1'-Bicyclohexyl]-4-carboxylic acid, 4'-propyl- . |
| Flash Point: | 178.8°C |
| Usage: |
4-trans-Propyl cyclohexyl cyclohexyl carboxylic acid (CAS NO.65355-32-0) has been used for intermediate of liquid crystals. |
| Safety Data | |
 |
|
