| Identification |
| Name: | 5H-[1]Benzopyrano[2,3-b]pyridin-5-one |
| Synonyms: | 4-Azaxanthone;5-Oxo-5H-[1]benzopyrano[2,3-b]pyridine;9-Oxa-1-azaanthrone;1-Azaxanthone; |
| CAS: | 6537-46-8 |
| EINECS: | -0 |
| Molecular Formula: | C12H7NO2 |
| Molecular Weight: | 197.18948 |
| InChI: | InChI=1S/C12H7NO2/c14-12-8-4-1-2-5-9(8)15-10-6-3-7-13-11(10)12/h1-7H |
| Molecular Structure: |
![(C12H7NO2) 4-Azaxanthone;5-Oxo-5H-[1]benzopyrano[2,3-b]pyridine;9-Oxa-1-azaanthrone;1-Azaxanthone;](https://img.guidechem.com/casimg/6537-46-8.gif) |
| Properties |
| Flash Point: | 184°C |
| Boiling Point: | 380.6°C at 760 mmHg |
| Density: | 1.342g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.651 |
| Water Solubility: | Stability Stable. Combustible. Incompatible withstrong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning of any toxicolo |
| Solubility: | |
| Appearance: | solid |
| Flash Point: | 184°C |
| Safety Data |
| |
 |
