| Identification | |
| Name: | Acetaldehyde,2-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]- |
| Synonyms: | Acetaldehyde,[(3,7-dimethyl-2,6-octadienyl)oxy]-, (E)-; Acetaldehyde,[[(2E)-3,7-dimethyl-2,6-octadienyl]oxy]- (9CI); Geranyloxyacetaldehyde |
| CAS: | 65405-73-4 |
| EINECS: | 265-743-7 |
| Molecular Formula: | C12H20 O2 |
| Molecular Weight: | 196.32 |
| InChI: | InChI=1/C12H20O2/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7-8H,4,6,9-10H2,1-3H3/b12-7+ |
| Molecular Structure: | ![(C12H20O2) Acetaldehyde,[(3,7-dimethyl-2,6-octadienyl)oxy]-, (E)-; Acetaldehyde,[[(2E)-3,7-dimethyl-2,6-octadie...](https://img1.guidechem.com/chem/e/dict/42/65405-73-4.jpg) |
| Properties | |
| Flash Point: | 104.4°C |
| Boiling Point: | 278.1°C at 760 mmHg |
| Density: | 0.904g/cm3 |
| Refractive index: | 1.459 |
| Specification: |
(E)-[(3,7-Dimethyl-2,6-octadienyl)oxy]acetaldehyde with CAS number of 65405-73-4 is also called for (E)-[(3,7-dimethyl-2,6-octadienyl)oxy]acetaldehyde ; Acetaldehyde, (2E)-3,7-dimethyl-2,6-octadienyloxy- ; (E)-[(3,7-Dimethyl-2,6-octadienyl)oxy]acetaldehyd ; [(3,7-dimethyl-2,6-octadienyl) oxy]-, (E)-Acetaldehyde ; [[(2E)-3,7-Dimethyl-2,6-octadienyl]oxy]acetaldehyde . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 104.4°C |
| Safety Data | |
 |
|
