| Identification | |
| Name: | cis-3-Hexenyl salicylate |
| Synonyms: | Benzoicacid, 2-hydroxy-, (3Z)-3-hexenyl ester (9CI);Benzoic acid, 2-hydroxy-,3-hexenyl ester, (Z)-; |
| CAS: | 65405-77-8 |
| EINECS: | 265-745-8 |
| Molecular Formula: | C13H16O3 |
| Molecular Weight: | 220.26434 |
| InChI: | InChI=1S/C13H16O3/c1-2-3-4-7-10-16-13(15)11-8-5-6-9-12(11)14/h3-6,8-9,14H,2,7,10H2,1H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.059 |
| Refractive index: | 1.521 |
| Water Solubility: | insoluble in water,Organic solvents: Soluble |
| Solubility: | insoluble in water,Organic solvents: Soluble |
| Appearance: | Colorless to pale yellow liquid |
| Specification: |
cis-3-Hexenyl salicylate (CAS NO.65405-77-8) also can be called (3Z)-3-Hexen-1-yl salicylate ; 3-Hexenyl salicylate ; Benzoic acid, 2-hydroxy-, 3-hexenyl ester, (Z)- ; Benzoic acid, 2-hydroxy-, (3Z)-3-hexen-1-yl ester and Benzoic acid, 2-hydroxy-, (3Z)-3-hexenyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
