Identification |
Name: | 1H,3H,5H-Oxazolo[3,4-c]oxazole-7a(7H)-methanol |
Synonyms: | 1-Aza-3,7-dioxa-5-hydroxymethylbicyclo[3.3.0]octane;1-Aza-3,7-dioxabicyclo[3.3.0]oct-5-ylmethanol; 1-Aza-5-hydroxymethyl-3,7-dioxabicyclo[3.3.0]octane;1-Aza-5-methylol-3,7-dioxabicyclo[3.3.0]octane;5-Hydroxymethyl-1-aza-3,7-dioxabicyclo[3.3.0]octane;5-Methylol-1-aza-3,7-dioxabicyclo[3.3.0]octane; Bonding agent M 3; GDUE; M 3; M3 (curing agent); NSC 270787; OXD-II; Oxazolidine T; ZT 65; Zoldine ZT 100;Zoldine ZT 40; Zoldine ZT 55; Zoldine ZT 65 |
CAS: | 6542-37-6 |
EINECS: | 229-457-6 |
Molecular Formula: | C6H11 N O3 |
Molecular Weight: | 145.18 |
InChI: | InChI=1/C6H11NO3/c8-1-6-2-9-4-7(6)5-10-3-6/h8H,1-5H2 |
Molecular Structure: |
|
Properties |
Flash Point: | >230 °F |
Boiling Point: | 258°C at 760 mmHg |
Density: | 1.125 g/mL at 25 °C |
Refractive index: | n20/D 1.424 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Report: |
EPA FIFRA 1988 pesticide subject to registration or re-registration.
1. |
|
orl-mus LD50:5 mg/kg
|
|
USXXAM United States Patent Document. (Commissioner of Patents and Trademarks, Washington, DC 20231) #3824309 . |
|
|
|
Consensus Reports:
|
Reported in EPA TSCA Inventory.
Flash Point: | >230 °F |
Safety Data |
|
|