| Identification |
| Name: | 9H-Pyrido[3,4-b]indole-3-methanol |
| Synonyms: | 3-Hydroxymethyl-b-carboline;9H-b-Carbolin-3-ylmethanol; |
| CAS: | 65474-79-5 |
| Molecular Formula: | C12H10N2O |
| Molecular Weight: | 198.2206 |
| InChI: | InChI=1S/C12H10N2O/c15-7-8-5-10-9-3-1-2-4-11(9)14-12(10)6-13-8/h1-6,14-15H,7H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.385 g/cm3 |
| Refractive index: | 1.795 |
| Water Solubility: | Soluble in DMSO (10mg/ ml), Soluble in ethanol,methanol or 0.1N HCI; insoluble in water and 0.1N NaOH |
| Solubility: | Soluble in DMSO (10mg/ ml), Soluble in ethanol,methanol or 0.1N HCI; insoluble in water and 0.1N NaOH |
| Appearance: | Yellow solid |
| Safety Data |
| |
 |
