| Identification | |
| Name: | 2-Fluorothioanisole |
| Synonyms: | Sulfide,o-fluorophenyl methyl (6CI,7CI,8CI);2-Fluorophenyl methyl sulfide;o-Fluorophenyl methyl sulfide; |
| CAS: | 655-20-9 |
| Molecular Formula: | C7H7FS |
| Molecular Weight: | 142.19 |
| InChI: | InChI=1/C7H7FS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.174 |
| Refractive index: | 1.5590 |
| Specification: |
2-Fluorothioanisole , with CAS number of 655-20-9, can be called benzene, 1-fluoro-2-(methylthio)- ; 1-Fluoro-2-(methylsulfanyl)benzene ; 2-Fluorophenyl methyl sulfide . |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
