| Identification | |
| Name: | 2,4-Imidazolidinedione,5-ethyl-5-phenyl-, (5S)- |
| Synonyms: | 2,4-Imidazolidinedione,5-ethyl-5-phenyl-, (S)-; (+)-5-Ethyl-5-phenylhydantoin;(+)-5-Phenyl-5-ethylhydantoin; (+)-Nirvanol; (S)-(+)-Nirvanol;(S)-5-Ethyl-5-phenyl-2,4-imidazolidinedione; (S)-5-Phenyl-5-ethylhydantoin;(S)-Nirvanol |
| CAS: | 65567-34-2 |
| Molecular Formula: | C11H12 N2 O2 |
| Molecular Weight: | 204.22 |
| InChI: | InChI=1/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15) |
| Molecular Structure: |  |
| Properties | |
| Specification: | Off-White Solid usageEng:An anticonvulsant, hypnotic. A metabolite of Mephentoin Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Storage Temperature: | 2-8°C |
| Color: | off-white |
| Usage: | An anticonvulsant, hypnotic. A metabolite of Mephentoin |
| Safety Data | |
 |
|
