Identification |
Name: | ethenol; 1-ethenoxyethoxyethylene; vinyl acetate |
Synonyms: | AC1O5AXI;Vinyl alcohol-vinyl acetate-vinyl acetal polymer;1,1-bis(ethenoxy)ethane; ethenol; ethenyl acetate;Acetic acid ethenyl ester, polymer with ethenol and 1,1'-(ethylidenebis(oxy))bis(ethene);65652-37-1 |
CAS: | 65652-37-1 |
Molecular Formula: | C12H20O5 |
Molecular Weight: | 244.2842 |
InChI: | InChI=1/C6H10O2.C4H6O2.C2H4O/c1-4-7-6(3)8-5-2;1-3-6-4(2)5;1-2-3/h4-6H,1-2H2,3H3;3H,1H2,2H3;2-3H,1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 20.7°C |
Boiling Point: | 121.3°C at 760 mmHg |
Flash Point: | 20.7°C |
Safety Data |
|
 |