Identification |
Name: | Pentanedioic acid, dimethyl ester, polymer with 2,2'-thiobis[ethanol] |
Synonyms: | Pentanedioic acid, dimethyl ester, polymer with 2,2'-thiobis[ethanol] |
CAS: | 65665-46-5 |
Molecular Formula: | C11H22O6S |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H12O4.C4H10O2S/c1-10-6(8)4-3-5-7(9)11-2;5-1-3-7-4-2-6/h3-5H2,1-2H3;5-6H,1-4H2 |
Molecular Structure: |
![(C11H22O6S) Pentanedioic acid, dimethyl ester, polymer with 2,2'-thiobis[ethanol]](https://img.guidechem.com/crawlimg/65665-46-5.png) |
Properties |
Flash Point: | 103.3°C |
Boiling Point: | 211.2°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 103.3°C |
Safety Data |
|
 |