Identification |
Name: | 4-hydroxytriazolam |
Synonyms: | 8-Chloro-6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-ol |
CAS: | 65686-11-5 |
Molecular Formula: | C17H12Cl2N4O |
Molecular Weight: | 0 |
InChI: | InChI=1/C17H12Cl2N4O/c1-9-21-22-16-17(24)20-15(11-4-2-3-5-13(11)19)12-8-10(18)6-7-14(12)23(9)16/h2-8,17,24H,1H3 |
Molecular Structure: |
![(C17H12Cl2N4O) 8-Chloro-6-(2-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-ol](https://img.guidechem.com/structure/65686-11-5.gif) |
Properties |
Flash Point: | 307.4°C |
Boiling Point: | 584.7°C at 760 mmHg |
Density: | 1.54g/cm3 |
Refractive index: | 1.74 |
Specification: | Yellow Solid usageEng:A metabolite of Triazolam (T767380). |
Flash Point: | 307.4°C |
Usage: | A metabolite of Triazolam |
Safety Data |
|
 |