| Identification | |
| Name: | 3,5-Dichlorobenzonitrile |
| Synonyms: | - |
| CAS: | 6575-00-4 |
| EINECS: | 229-495-3 |
| Molecular Formula: | C7H3Cl2N |
| Molecular Weight: | 172.01 |
| InChI: | InChI=1/C7H3Cl2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.4 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.584 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Removal in wastewater treatment of 3,5-Dichlorobenzonitrile (6575-00-4) can be stated as follows: |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
