| Identification | |
| Name: | 2,1,3-Benzothiadiazole,5-(bromomethyl)- |
| Synonyms: | 5-(Bromomethyl)benzo-2,1,3-thiadiazole;5-(Bromomethyl)benzo[c][1,2,5]thiadiazole; 5-Bromomethylbenzo[1,2,5]thiadiazole |
| CAS: | 65858-50-6 |
| Molecular Formula: | C7H5 Br N2 S |
| Molecular Weight: | 229.1 |
| InChI: | InChI=1/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
| Molecular Structure: | ![(C7H5BrN2S) 5-(Bromomethyl)benzo-2,1,3-thiadiazole;5-(Bromomethyl)benzo[c][1,2,5]thiadiazole; 5-Bromomethylbenzo...](https://img1.guidechem.com/chem/e/dict/15/65858-50-6.jpg) |
| Properties | |
| Melting Point: | 91 °C |
| Flash Point: | 134.8°C |
| Boiling Point: | 299.3°C at 760 mmHg |
| Density: | 1.776g/cm3 |
| Refractive index: | 1.726 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 134.8°C |
| Safety Data | |
 |
|
