Identification |
Name: | Thiourea,N-(2,6-dichlorophenyl)- |
Synonyms: | Thiourea,(2,6-dichlorophenyl)- (9CI); Urea, 1-(2,6-dichlorophenyl)-2-thio- (7CI,8CI);1-(2,6-Dichlorophenyl)thiourea; 2,6-Dichlorophenylthiourea |
CAS: | 6590-91-6 |
EINECS: | -0 |
Molecular Formula: | C7H6 Cl2 N2 S |
Molecular Weight: | 221.10 |
InChI: | InChI=1/C7H6Cl2N2S/c8-4-2-1-3-5(9)6(4)11-7(10)12/h1-3H,(H3,10,11,12) |
Molecular Structure: |
|
Properties |
Density: | 1.563 g/cm3 |
Refractive index: | 1.73 |
Appearance: | white |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
|