Identification |
Name: | 1H-Imidazole,2-bromo-5-nitro- |
Synonyms: | 1H-Imidazole,2-bromo-4-nitro- (9CI); 2-Bromo-4-nitro-1H-imidazole; 2-Bromo-4-nitroimidazole |
CAS: | 65902-59-2 |
Molecular Formula: | C3H2 Br N3 O2 |
Molecular Weight: | 191.97 |
InChI: | InChI=1/C3H2BrN3O2/c4-3-5-1-2(6-3)7(8)9/h1H,(H,5,6) |
Molecular Structure: |
 |
Properties |
Melting Point: | 180 -182ºC |
Density: | 2.156 g/cm3 |
Refractive index: | 1.663 |
Appearance: | Pale yellow crystal |
Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
|
 |