Identification |
Name: | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
Synonyms: | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
CAS: | 65916-89-4 |
Molecular Formula: | C15H10N2O2 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C15H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8H,9H2 |
Molecular Structure: |
![(C15H10N2O2) 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene](https://img.guidechem.com/structure/65916-89-4.gif) |
Properties |
Melting Point: | 37 deg C |
Boiling Point: | 196 DEG C @ 5 MM HG |
Solubility: | Sol in acetone, benzene, kerosene, and nitrobenzene. |
Color: | Light-yellow, fused solid Crystals White to light yellow flakes [Note: A liquid above 99 degrees F]. |
Safety Data |
|
 |