| Identification |
| Name: | 1,10-Phenanthroline |
| Synonyms: | 1,10-Phenanthroline anhydrous; 1,10-Phenanthroline hydrochloride monohydrate |
| CAS: | 66-71-7 |
| EINECS: | 200-629-2 |
| Molecular Formula: | C12H8N2 |
| Molecular Weight: | 180.21 |
| InChI: | InChI=1/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.25 g/cm3 |
| Stability: | Stable. Hygroscopic. Store under nitrogen. Incompatible with strong acids, strong oxidizing agents. |
| Water Solubility: | slightly soluble |
| Solubility: | Slightly soluble SOLVENT |
| Appearance: | white crystalline powder |
| Packinggroup: | III |
| HS Code: | 29339990 |
| Storage Temperature: | Store in a cool, dry place. Keep containers tightly closed. Storage under a nitrogen blanket has been recommended. |
| Sensitive: | Hygroscopic |
| Usage: | Forms a complex compound with ferrous ions which is used under the name of ferroin â as an indicator in oxidation reduction systems, e.G., Titration of ferrous salts. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
