| Identification | |
| Name: | 1-Naphthaldehyde |
| Synonyms: | 1-Naphthaldehyde(8CI);1-Formylnaphthalene;1-Naphthylcarboxaldehyde;NSC6106;Naphthalene-1-aldehyde;Naphthalene-1-carbaldehyde;a-Naphthaldehyde;a-Naphthalenecarboxaldehyde;a-Naphthylcarboxaldehyde; |
| CAS: | 66-77-3 |
| EINECS: | 200-633-4 |
| Molecular Formula: | C11H8O |
| Molecular Weight: | 156.18 |
| InChI: | InChI=1/C11H8O/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3082 |
| Density: | 1.15 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.65-1.654 |
| Solubility: | Insoluble |
| Appearance: | Light-yellow oil-like liquid |
| Specification: |
?1-Naphthaldehyde , its CAS NO. is 66-77-3, the synonyms are 1-Formylnaphthalene ; 1-Naphthalenecarboxaldehyde ; alpha-Naphthal ; alpha-Naphthaldehyde ; alpha-Naphthylaldehyde ; alpha-Naphthylcarboxaldehyde . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29122900 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
