Identification |
Name: | 1,3-Propanediamine, N,N-dimethyl-, polymer with (chloromethyl)oxirane, sulfate |
Synonyms: | 1,3-Propanediamine, N,N-dimethyl-, polymer with (chloromethyl)oxirane, sulfate;N,N-Dimethyl-1,3-propanediamine, chloromethyloxirane polymer, sulfuric acid salt;Sulfuric acid salt of N,N-dimethyl-1,3-propanediamine polymer with 1-chloro-2,3-epoxypropane |
CAS: | 66037-36-3 |
Molecular Formula: | C8H21ClN2O5S |
Molecular Weight: | 0 |
InChI: | InChI=1/C5H14N2.C3H5ClO.H2O4S/c1-7(2)5-3-4-6;4-1-3-2-5-3;1-5(2,3)4/h3-6H2,1-2H3;3H,1-2H2;(H2,1,2,3,4) |
Molecular Structure: |
|
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 129.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 15.6°C |
Safety Data |
|
|