| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 1,1'-(1,6-hexanediyl) ester |
| Synonyms: | 2-Propenoicacid, 2-methyl-, 1,6-hexanediyl ester (9CI); Methacrylic acid, hexamethyleneester (7CI,8CI); 1,6-Hexanediol, dimethacrylate (8CI); 1,6-Hexamethylenedimethacrylate; 1,6-Hexamethylene glycol dimethacrylate; 1,6-Hexamethylenedioldimethacrylate; 1,6-Hexanediyl dimethacrylate; 1,6-Hexyleneglycoldimethacrylate; Acryester HX; HDDMA; Hexamethylene dimethacrylate;Hexamethylene glycol dimethacrylate; Hexamethylene glycol methacrylate;Hexamethylene methacrylate; Light Ester 1.6HX; Monocizer TD 1520; NK Ester HD;NK Ester HD-N; SR 239; SR 239A; Sartomer 239 |
| CAS: | 6606-59-3 |
| EINECS: | 229-551-7 |
| Molecular Formula: | C14H22 O4 |
| Molecular Weight: | 254.32 |
| InChI: | InChI=1/C14H22O4/c1-11(2)13(15)17-9-7-5-6-8-10-18-14(16)12(3)4/h1,3,5-10H2,2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Flash Point: | >230 °F |
| Boiling Point: | 315 ºC |
| Density: | 0.995 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.457-1.459 |
| Specification: |
1,6-Hexanediol dimethacrylate , its cas register number is 6606-59-3. It also can be called 2-Propenoic acid,2-methyl-, 1,1'-(1,6-hexanediyl) ester ; 1,6-Hexanediyl bismethacrylate ; 2-Propenoic acid, 2-methyl-, 1,6-hexanediyl ester .It is a clear liquid. |
| Flash Point: | >230 °F |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
