| Identification | |
| Name: | Enbucrilate |
| Synonyms: | Acrylicacid, 2-cyano-, butyl ester (6CI,7CI,8CI);BK 201 (adhesive);BK 301 (adhesive);Butyl 2-cyanoacrylate;Butyl cyanoacrylate;Butyl a-cyanoacrylate;Histacryl Blue;Indermil;InteguSeal Clear;Integuseal;Integuseal MicrobialSealant;Sicomet 6000;Tisuacryl;n-Butyl 2-cyanoacrylate; |
| CAS: | 6606-65-1 |
| EINECS: | 229-552-2 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.17844 |
| InChI: | InChI=1/C7H11NO/c1-2-3-4-7(9)5-6-8/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.005 g/cm3 |
| Refractive index: | 1.425 |
| Specification: |
Enbucrilate , with CAS number is 6606-65-1, can be called Butyl 2-cyano-2-propenoate ; n-Butyl 2-cyanoacrylate ; Integuseal MicrobialSealant ; InteguSeal Clear ; Histacryl Blue ; Butyl a-cyanoacrylate ; Butyl cyanoacrylate ; Butyl 2-cyanoacrylate . |
| Safety Data | |
 |
|
