Identification |
Name: | 1,4,7-Trioxacyclotridecane-8,13-dione |
Synonyms: | Adipicacid, cyclic diester with diethylene glycol (8CI); Adipic acid, cyclic esterwith diethylene glycol (7CI); Diethylene glycol, cyclic adipate; Cyclicdiethylene glycol adipate |
CAS: | 6607-34-7 |
EINECS: | 229-554-3 |
Molecular Formula: | C10H16 O5 |
Molecular Weight: | 236.22068 |
InChI: | InChI=1/C10H16O5/c11-9-3-1-2-4-10(12)15-8-6-13-5-7-14-9/h1-8H2 |
Molecular Structure: |
![(C10H16O5) Adipicacid, cyclic diester with diethylene glycol (8CI); Adipic acid, cyclic esterwith diethylene gl...](https://img1.guidechem.com/chem/e/dict/43/6607-34-7.jpg) |
Properties |
Flash Point: | 208.9°C |
Boiling Point: | 458.1°C at 760 mmHg |
Density: | 1.099g/cm3 |
Refractive index: | 1.433 |
Flash Point: | 208.9°C |
Safety Data |
|
![](/images/detail_15.png) |