Identification |
Name: | 2-methoxybenzonitrile |
Synonyms: | 2-Methoxybenzonitrile, (o-Anisonitrile); o-Anisonitrile |
CAS: | 6609-56-9 |
EINECS: | 229-559-0 |
Molecular Formula: | C8H7NO |
Molecular Weight: | 133.15 |
InChI: | InChI=1/C8H7NO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 3276 |
Melting Point: | 24.5 |
Density: | 1.093 |
Refractive index: | 1.5465 |
Appearance: | Colorless to yellow clear liquid |
Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Storage Temperature: | Room temperature. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |