| Identification | |
| Name: | 2-methoxybenzonitrile |
| Synonyms: | 2-Methoxybenzonitrile, (o-Anisonitrile); o-Anisonitrile |
| CAS: | 6609-56-9 |
| EINECS: | 229-559-0 |
| Molecular Formula: | C8H7NO |
| Molecular Weight: | 133.15 |
| InChI: | InChI=1/C8H7NO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Melting Point: | 24.5 |
| Density: | 1.093 |
| Refractive index: | 1.5465 |
| Appearance: | Colorless to yellow clear liquid |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
