| Identification |
| Name: | 2-Methyl-2-propenoic acid, butyl 2-propenoate, butyl 2-methyl-2-propenoate polymer |
| Synonyms: | butyl 2-methylprop-2-enoate; butyl prop-2-enoate; 2-methylprop-2-enoic acid;30231-49-3;AC1Q66TD;AC1L536X;AR-1I1177;2-Methyl-2-propenoic acid, butyl 2-propenoate, butyl 2-methyl-2-propenoate polymer;2-Propenoic acid, 2-methyl-, polymer with butyl 2-methyl-2-propenoate and butyl 2-propenoate;470464-68-7 |
| CAS: | 66105-83-7 |
| Molecular Formula: | C19H32O6 |
| Molecular Weight: | 356.45378 |
| InChI: | InChI=1S/C8H14O2.C7H12O2.C4H6O2/c1-4-5-6-10-8(9)7(2)3;1-3-5-6-9-7(8)4-2;1-3(2)4(5)6/h2,4-6H2,1,3H3;4H,2-3,5-6H2,1H3;1H2,2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 50.6°C |
| Boiling Point: | 160°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 50.6°C |
| Safety Data |
| |
 |
