Identification |
Name: | Pyridine-2,3,4,6-d4,5-(2-pyrrolidinyl)- (9CI) |
CAS: | 66148-18-3 |
Molecular Formula: | C9H8D4N2 |
Molecular Weight: | 152.23 |
InChI: | InChI=1/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/i1D,3D,5D,7D |
Molecular Structure: |
 |
Properties |
Flash Point: | 111.291°C |
Boiling Point: | 269.999°C at 760 mmHg |
Density: | 1.071g/cm3 |
Refractive index: | 1.536 |
Appearance: | colourless oil |
Specification: | Colourless Oil usageEng:Labelled (RS)-Nornicotine (N757000). (RS)-Nornicotine is a tobacco alkaloid and the major Nicotine (N412420) metabolite in brain. Nornicotine appears to activate different nAChR subtypes, has a better pharmacokinetic profile, and produces less toxicity than Nicotine. Nornicotine shows a significant analgesic activity. |
Flash Point: | 111.291°C |
Usage: | Labelled (RS)-Nornicotine (N757000). (RS)-Nornicotine is a tobacco alkaloid and the major Nicotine (N412420) metabolite in brain. Nornicotine appears to activate different nAChR subtypes, has a better pharmacokinetic profile, and produces less toxicity than Nicotine. Nornicotine shows a significant analgesic activity. |
Safety Data |
|
 |