| Identification |
| Name: | 2,4-Pentanedione,ion(1-), rubidium (9CI) |
| Synonyms: | (Acetylacetonato)rubidium;Rubidium acetylacetonate |
| CAS: | 66169-93-5 |
| EINECS: | 266-210-1 |
| Molecular Formula: | C5H7 O2 . Rb |
| Molecular Weight: | 184.58 |
| InChI: | InChI=1/C5H8O2.Rb/c1-4(6)3-5(2)7;/h3,6H,1-2H3;/q;+1/p-1/b4-3-; |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | ca. 200 C (decomposes) |
| Flash Point: | 71.9°C |
| Boiling Point: | 187.6°C at 760 mmHg |
| Stability: | Stable, but may decompose upon exposure to air. Incompatible with strong acids, strong bases, strong reducing agents. |
| Appearance: | tan powder or chunks |
| Flash Point: | 71.9°C |
| Safety Data |
| |
 |
