Identification |
Name: | 2,4-Pentanedione,ion(1-), rubidium (9CI) |
Synonyms: | (Acetylacetonato)rubidium;Rubidium acetylacetonate |
CAS: | 66169-93-5 |
EINECS: | 266-210-1 |
Molecular Formula: | C5H7 O2 . Rb |
Molecular Weight: | 184.58 |
InChI: | InChI=1/C5H8O2.Rb/c1-4(6)3-5(2)7;/h3,6H,1-2H3;/q;+1/p-1/b4-3-; |
Molecular Structure: |
 |
Properties |
Melting Point: | ca. 200 C (decomposes) |
Flash Point: | 71.9°C |
Boiling Point: | 187.6°C at 760 mmHg |
Stability: | Stable, but may decompose upon exposure to air. Incompatible with strong acids, strong bases, strong reducing agents. |
Appearance: | tan powder or chunks |
Flash Point: | 71.9°C |
Safety Data |
|
 |