| Identification | |
| Name: | METHYL 2-(2-FLUORO-BIPHENYL-4YL)PROPIONATE |
| Synonyms: | METHYL 2-(2-FLUORO-BIPHENYL-4YL)PROPIONATE;2-Fluoro-a-methyl-[1,1'-biphenyl]-4-acetic Acid Methyl Ester;Flurbiprofen methyl ester;Methyl Flurbiprofen |
| CAS: | 66202-86-6 |
| Molecular Formula: | C16H15FO2 |
| Molecular Weight: | 258.2875032 |
| InChI: | InChI=1/C16H15FO2/c1-11(16(18)19-2)13-8-9-14(15(17)10-13)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| Molecular Structure: | ![(C16H15FO2) METHYL 2-(2-FLUORO-BIPHENYL-4YL)PROPIONATE;2-Fluoro-a-methyl-[1,1'-biphenyl]-4-acetic Acid Methyl Es...](https://img.guidechem.com/structure/66202-86-6.gif) |
| Properties | |
| Flash Point: | 152.6°C |
| Boiling Point: | 337.3°C at 760 mmHg |
| Density: | 1.127g/cm3 |
| Refractive index: | 1.536 |
| Specification: | White Solid usageEng:Prodrug of Flurbiprofen. An intermediate for the synthesis of the metabolite of Flurbiprofen, an anti-inflammatory used as an analgesic. |
| Flash Point: | 152.6°C |
| Storage Temperature: | Refrigerator |
| Usage: | Prodrug of Flurbiprofen. An intermediate for the synthesis of the metabolite of Flurbiprofen, an anti-inflammatory used as an analgesic. |
| Safety Data | |
 |
|
