| Identification | |
| Name: | Phenol,2-amino-4,5-dimethyl- |
| Synonyms: | 3,4-Xylenol,6-amino- (6CI,7CI,8CI); 1-Amino-2-hydroxy-4,5-dimethylbenzene;2-Amino-4,5-dimethylphenol; 4,5-Dimethyl-2-aminophenol; 4,5-Dimethyl-2-hydroxyaniline;4-Amino-5-hydroxy-1,2-xylene; NSC 54925 |
| CAS: | 6623-41-2 |
| EINECS: | 229-578-4 |
| Molecular Formula: | C8H11 N O |
| Molecular Weight: | 137.20 |
| InChI: | InChI=1/C8H11NO/c1-5-3-7(9)8(10)4-6(5)2/h3-4,10H,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.118 g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
2-Amino-4,5-dimethylphenol ,its cas register number is 6623-41-2. It also can be called 3,4-Xylenol, 6-amino- (8CI) ; Phenol, 2-amino-4,5-dimethyl- ; and 2-Amino-4,5-xylenol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
