| Identification |
| Name: | Acetic acid, ethenyl ester, polymer with 2-propenoic acid and 2-propenoic acid, isooctyl ester |
| Synonyms: | 2-Propenoic acid, polymer with ethenyl acetate and isooctyl 2-propenoate;Acetic acid, ethenyl ester, polymer with 2-propenoic acid and 2-propenoic acid, isooctyl ester |
| CAS: | 66251-44-3 |
| Molecular Formula: | C19H32O6 |
| Molecular Weight: | 356.45378 |
| InChI: | InChI=1S/C11H20O2.2C4H6O2/c1-4-11(12)13-9-7-5-6-8-10(2)3;1-3-6-4(2)5;1-3(2)4(5)6/h4,10H,1,5-9H2,2-3H3;3H,1H2,2H3;1H2,2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Safety Data |
| |
 |
