| Identification | |
| Name: | 2-Propenoic acid, polymer with ethenylbenzene and isooctyl 2-propenoate |
| Synonyms: | AC1O5B6R;Ethenylbenzene, 2-propenoic acid, 2-propenoic acid, isooctyl ester polymer;6-methylheptyl prop-2-enoate; 2-methylprop-2-enoic acid; styrene;2-Propenoic acid, polymer with ethenylbenzene and isooctyl 2-propenoate;66251-45-4 |
| CAS: | 66251-45-4 |
| Molecular Formula: | C23H34O4 |
| Molecular Weight: | 374.5137 |
| InChI: | InChI=1S/C11H20O2.C8H8.C4H6O2/c1-4-11(12)13-9-7-5-6-8-10(2)3;1-2-8-6-4-3-5-7-8;1-3(2)4(5)6/h4,10H,1,5-9H2,2-3H3;2-7H,1H2;1H2,2H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 227.7°Cat760mmHg |
| Boiling Point: | 227.7°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 227.7°Cat760mmHg |
| Safety Data | |
 |
|
