| Identification |
| Name: | Phenol,2-bromo-4-methyl- |
| Synonyms: | p-Cresol,2-bromo- (6CI,7CI,8CI);2-Bromo-4-cresol;2-Bromo-4-methylphenol;2-Bromo-p-cresol;3-Bromo-4-hydroxytoluene;NSC 60115; |
| CAS: | 6627-55-0 |
| EINECS: | 229-595-7 |
| Molecular Formula: | C7H7BrO |
| Molecular Weight: | 187.03 |
| InChI: | InChI=1/C7H7BrO/c1-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.547 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.576-1.579 |
| Solubility: | Insoluble |
| Appearance: | clear colourless to pale yellow liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
