| Identification | |
| Name: | Ethanone,1-(2,3,4,5-tetrafluorophenyl)- |
| Synonyms: | 2',3',4',5'-Tetrafluoroacetophenone |
| CAS: | 66286-21-3 |
| Molecular Formula: | C8H4 F4 O |
| Molecular Weight: | 192.11 |
| InChI: | InChI=1/C8H4F4O/c1-3(13)4-2-5(9)7(11)8(12)6(4)10/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 156 °F |
| Density: | 1.408 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.453(lit.) |
| Specification: |
2',3',4',5'-Tertafluoroacetophenone , its cas register number is 66286-21-3. It also can be called 1-(2,3,4,5-Tetrafluorophenyl)ethanone ; Ethanone, 1-(2,3,4,5-tetrafluorophenyl)- ; m-Fluorotrifluoroacetophenone ; and p-Fluorotrifluoroacetophenone . |
| Flash Point: | 156 °F |
| Safety Data | |
 |
|
